ChemNet > CAS > 247170-25-8 5-chloro-2-fluorophenyl isothiocyanate
247170-25-8 5-chloro-2-fluorophenyl isothiocyanate
| نام محصول |
5-chloro-2-fluorophenyl isothiocyanate |
| مترادف |
4-chloro-1-fluoro-2-isothiocyanatobenzene |
| میدان مغناطیسی |
C7H3ClFNS |
| وزن مولکولی |
187.6218 |
| InChI |
InChI=1/C7H3ClFNS/c8-5-1-2-6(9)7(3-5)10-4-11/h1-3H |
| شماره سیایاس |
247170-25-8 |
| ساختار مولکولی |
|
| تراکم |
1.31g/cm3 |
| نقطه غلیان |
272.6°C at 760 mmHg |
| ضریب شکست |
1.576 |
| نقطه اشتعال |
118.6°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
